C8H16O6 — CID 87130889
(2S,3S,4R,5R)-2-propoxyoxane-2,3,4,5-tetrol (PubChem CID 87130889) has the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-propoxyoxane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4R,5R)-2-propoxyoxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 87130889 |
| Molecular Formula | C8H16O6 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | (2S,3S,4R,5R)-2-propoxyoxane-2,3,4,5-tetrol |
| SMILES | CCCO[C@]1(O)OC[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H16O6/c1-2-3-13-8(12)7(11)6(10)5(9)4-14-8/h5-7,9-12H,2-4H2,1H3/t5-,6-,7+,8+/m1/s1 |
| InChIKey | KJNRHAMZVRMAMV-NGJRWZKOSA-N |
| XLogP | -1.83 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|