C36H37F5O7S2 — CID 87130994
2-(3-cyclohexyloxycarbonylbicyclo[2.2.1]heptane-2-carbonyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;triphenylsulfanium (PubChem CID 87130994) has the molecular formula C36H37F5O7S2 and a molecular weight of 740.81 g/mol. Its IUPAC name is 2-(3-cyclohexyloxycarbonylbicyclo[2.2.1]heptane-2-carbonyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;triphenylsulfanium.
| Compound Name | 2-(3-cyclohexyloxycarbonylbicyclo[2.2.1]heptane-2-carbonyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 87130994 |
| Molecular Formula | C36H37F5O7S2 |
| Molecular Weight | 740.81 g/mol |
| Exact Mass | 740.19 |
| IUPAC Name | 2-(3-cyclohexyloxycarbonylbicyclo[2.2.1]heptane-2-carbonyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;triphenylsulfanium |
| SMILES | O=C(OC1CCCCC1)C1C2CCC(C2)C1C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H23F5O7S.C18H15S/c19-17(20,21)16(18(22,23)31(26,27)28)30-15(25)13-10-7-6-9(8-10)12(13)14(24)29-11-4-2-1-3-5-11;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h9-13,16H,1-8H2,(H,26,27,28);1-15H/q;+1/p-1 |
| InChIKey | XDPFEVJXTRAMBA-UHFFFAOYSA-M |
| XLogP | 7.92 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.81 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|