C28H42O11 — CID 87131387
[3-[2,2-dimethyl-3-(6-prop-2-enoyloxyhexanoyloxy)propanoyl]oxy-2,2-dimethyl-3-oxopropyl] 6-prop-2-enoyloxyhexanoate (PubChem CID 87131387) has the molecular formula C28H42O11 and a molecular weight of 554.63 g/mol. Its IUPAC name is [3-[2,2-dimethyl-3-(6-prop-2-enoyloxyhexanoyloxy)propanoyl]oxy-2,2-dimethyl-3-oxopropyl] 6-prop-2-enoyloxyhexanoate.
| Compound Name | [3-[2,2-dimethyl-3-(6-prop-2-enoyloxyhexanoyloxy)propanoyl]oxy-2,2-dimethyl-3-oxopropyl] 6-prop-2-enoyloxyhexanoate |
|---|---|
| PubChem CID | 87131387 |
| Molecular Formula | C28H42O11 |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | [3-[2,2-dimethyl-3-(6-prop-2-enoyloxyhexanoyloxy)propanoyl]oxy-2,2-dimethyl-3-oxopropyl] 6-prop-2-enoyloxyhexanoate |
| SMILES | C=CC(=O)OCCCCCC(=O)OCC(C)(C)C(=O)OC(=O)C(C)(C)COC(=O)CCCCCOC(=O)C=C |
| InChI | InChI=1S/C28H42O11/c1-7-21(29)35-17-13-9-11-15-23(31)37-19-27(3,4)25(33)39-26(34)28(5,6)20-38-24(32)16-12-10-14-18-36-22(30)8-2/h7-8H,1-2,9-20H2,3-6H3 |
| InChIKey | HWDSIFJLOFRPCA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|