C6HCl5CoS — CID 87131562
cobalt;2,3,4,5,6-pentachlorobenzenethiol (PubChem CID 87131562) has the molecular formula C6HCl5CoS and a molecular weight of 341.34 g/mol. Its IUPAC name is cobalt;2,3,4,5,6-pentachlorobenzenethiol.
| Compound Name | cobalt;2,3,4,5,6-pentachlorobenzenethiol |
|---|---|
| PubChem CID | 87131562 |
| Molecular Formula | C6HCl5CoS |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 338.76 |
| IUPAC Name | cobalt;2,3,4,5,6-pentachlorobenzenethiol |
| SMILES | Sc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl.[Co] |
| InChI | InChI=1S/C6HCl5S.Co/c7-1-2(8)4(10)6(12)5(11)3(1)9;/h12H; |
| InChIKey | BENLMBJMFNHFSE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|