C36H54O6 — CID 87131736
2,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]hexanedioic acid (PubChem CID 87131736) has the molecular formula C36H54O6 and a molecular weight of 582.82 g/mol. Its IUPAC name is 2,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]hexanedioic acid.
| Compound Name | 2,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]hexanedioic acid |
|---|---|
| PubChem CID | 87131736 |
| Molecular Formula | C36H54O6 |
| Molecular Weight | 582.82 g/mol |
| Exact Mass | 582.39 |
| IUPAC Name | 2,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]hexanedioic acid |
| SMILES | CC(C)(C)c1cc(CC(CCC(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C(=O)O)C(=O)O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C36H54O6/c1-33(2,3)25-17-21(18-26(29(25)37)34(4,5)6)15-23(31(39)40)13-14-24(32(41)42)16-22-19-27(35(7,8)9)30(38)28(20-22)36(10,11)12/h17-20,23-24,37-38H,13-16H2,1-12H3,(H,39,40)(H,41,42) |
| InChIKey | NVCFQHRGRSKYLM-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.82 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |