About 1-buta-1,3-dien-2-ylpyrazole
1-buta-1,3-dien-2-ylpyrazole (PubChem CID 87131887) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-ylpyrazole.
Molecular Properties
| Compound Name | 1-buta-1,3-dien-2-ylpyrazole |
| PubChem CID | 87131887 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 1-buta-1,3-dien-2-ylpyrazole |
| SMILES | C=CC(=C)n1cccn1 |
| InChI | InChI=1S/C7H8N2/c1-3-7(2)9-6-4-5-8-9/h3-6H,1-2H2 |
| InChIKey | SEFQAPLGDKKZMI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-buta-1,3-dien-2-ylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-buta-1,3-dien-2-ylpyrazole?
The IUPAC name of 1-buta-1,3-dien-2-ylpyrazole (CID 87131887) is 1-buta-1,3-dien-2-ylpyrazole.
What is the SMILES notation for 1-buta-1,3-dien-2-ylpyrazole?
The canonical SMILES for 1-buta-1,3-dien-2-ylpyrazole is C=CC(=C)n1cccn1.
What is the InChIKey of 1-buta-1,3-dien-2-ylpyrazole?
The InChIKey is SEFQAPLGDKKZMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2/c1-3-7(2)9-6-4-5-8-9/h3-6H,1-2H2.
What are the key properties of 1-buta-1,3-dien-2-ylpyrazole?
1-buta-1,3-dien-2-ylpyrazole has a molecular weight of 120.15 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-buta-1,3-dien-2-ylpyrazole is sourced from PubChem (CID 87131887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).