About 3-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile
3-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile (PubChem CID 871320) has the molecular formula C11H8N2O2
and a molecular weight of 200.20 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile |
| PubChem CID | 871320 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 3-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile |
| SMILES | COc1ccc(-c2nocc2C#N)cc1 |
| InChI | InChI=1S/C11H8N2O2/c1-14-10-4-2-8(3-5-10)11-9(6-12)7-15-13-11/h2-5,7H,1H3 |
| InChIKey | RLBMVTBBQIJIAC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile?
The IUPAC name of 3-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile (CID 871320) is 3-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile.
What is the SMILES notation for 3-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile?
The canonical SMILES for 3-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile is COc1ccc(-c2nocc2C#N)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile?
The InChIKey is RLBMVTBBQIJIAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2/c1-14-10-4-2-8(3-5-10)11-9(6-12)7-15-13-11/h2-5,7H,1H3.
What are the key properties of 3-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile?
3-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile has a molecular weight of 200.20 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-1,2-oxazole-4-carbonitrile is sourced from PubChem (CID 871320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).