About CID 87132758
CID 87132758 (PubChem CID 87132758) has the molecular formula C9H22NO2Si
and a molecular weight of 204.37 g/mol.
Molecular Properties
| Compound Name | CID 87132758 |
| PubChem CID | 87132758 |
| Molecular Formula | C9H22NO2Si |
| Molecular Weight | 204.37 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | — |
| SMILES | CCO[Si](CCCN(C)C)OCC |
| InChI | InChI=1S/C9H22NO2Si/c1-5-11-13(12-6-2)9-7-8-10(3)4/h5-9H2,1-4H3 |
| InChIKey | RQSLPXSUXCHKMA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87132758 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87132758?
The IUPAC name of CID 87132758 (CID 87132758) is not available.
What is the SMILES notation for CID 87132758?
The canonical SMILES for CID 87132758 is CCO[Si](CCCN(C)C)OCC.
What is the InChIKey of CID 87132758?
The InChIKey is RQSLPXSUXCHKMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22NO2Si/c1-5-11-13(12-6-2)9-7-8-10(3)4/h5-9H2,1-4H3.
What are the key properties of CID 87132758?
CID 87132758 has a molecular weight of 204.37 g/mol, XLogP of 1.50, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87132758 is sourced from PubChem (CID 87132758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).