About 3-amino-3-(1-hydroxypentan-2-yl)-2,4-dipropylpentane-1,5-diol
3-amino-3-(1-hydroxypentan-2-yl)-2,4-dipropylpentane-1,5-diol (PubChem CID 87133239) has the molecular formula C16H35NO3
and a molecular weight of 289.46 g/mol. Its IUPAC name is 3-amino-3-(1-hydroxypentan-2-yl)-2,4-dipropylpentane-1,5-diol.
Molecular Properties
| Compound Name | 3-amino-3-(1-hydroxypentan-2-yl)-2,4-dipropylpentane-1,5-diol |
| PubChem CID | 87133239 |
| Molecular Formula | C16H35NO3 |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.26 |
| IUPAC Name | 3-amino-3-(1-hydroxypentan-2-yl)-2,4-dipropylpentane-1,5-diol |
| SMILES | CCCC(CO)C(N)(C(CO)CCC)C(CO)CCC |
| InChI | InChI=1S/C16H35NO3/c1-4-7-13(10-18)16(17,14(11-19)8-5-2)15(12-20)9-6-3/h13-15,18-20H,4-12,17H2,1-3H3 |
| InChIKey | IJAGVKZBODOOKQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-3-(1-hydroxypentan-2-yl)-2,4-dipropylpentane-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-(1-hydroxypentan-2-yl)-2,4-dipropylpentane-1,5-diol?
The IUPAC name of 3-amino-3-(1-hydroxypentan-2-yl)-2,4-dipropylpentane-1,5-diol (CID 87133239) is 3-amino-3-(1-hydroxypentan-2-yl)-2,4-dipropylpentane-1,5-diol.
What is the SMILES notation for 3-amino-3-(1-hydroxypentan-2-yl)-2,4-dipropylpentane-1,5-diol?
The canonical SMILES for 3-amino-3-(1-hydroxypentan-2-yl)-2,4-dipropylpentane-1,5-diol is CCCC(CO)C(N)(C(CO)CCC)C(CO)CCC.
What is the InChIKey of 3-amino-3-(1-hydroxypentan-2-yl)-2,4-dipropylpentane-1,5-diol?
The InChIKey is IJAGVKZBODOOKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35NO3/c1-4-7-13(10-18)16(17,14(11-19)8-5-2)15(12-20)9-6-3/h13-15,18-20H,4-12,17H2,1-3H3.
What are the key properties of 3-amino-3-(1-hydroxypentan-2-yl)-2,4-dipropylpentane-1,5-diol?
3-amino-3-(1-hydroxypentan-2-yl)-2,4-dipropylpentane-1,5-diol has a molecular weight of 289.46 g/mol, XLogP of 1.91, 12 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-(1-hydroxypentan-2-yl)-2,4-dipropylpentane-1,5-diol is sourced from PubChem (CID 87133239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).