About 3,8-dithiatricyclo[5.1.0.02,4]oct-5-en-4-ol
3,8-dithiatricyclo[5.1.0.02,4]oct-5-en-4-ol (PubChem CID 87133539) has the molecular formula C6H6OS2
and a molecular weight of 158.25 g/mol. Its IUPAC name is 3,8-dithiatricyclo[5.1.0.02,4]oct-5-en-4-ol.
Molecular Properties
| Compound Name | 3,8-dithiatricyclo[5.1.0.02,4]oct-5-en-4-ol |
| PubChem CID | 87133539 |
| Molecular Formula | C6H6OS2 |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 157.99 |
| IUPAC Name | 3,8-dithiatricyclo[5.1.0.02,4]oct-5-en-4-ol |
| SMILES | OC12C=CC3SC3C1S2 |
| InChI | InChI=1S/C6H6OS2/c7-6-2-1-3-4(8-3)5(6)9-6/h1-5,7H |
| InChIKey | VUBOQPNQIMKEKI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3,8-dithiatricyclo[5.1.0.02,4]oct-5-en-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dithiatricyclo[5.1.0.02,4]oct-5-en-4-ol?
The IUPAC name of 3,8-dithiatricyclo[5.1.0.02,4]oct-5-en-4-ol (CID 87133539) is 3,8-dithiatricyclo[5.1.0.02,4]oct-5-en-4-ol.
What is the SMILES notation for 3,8-dithiatricyclo[5.1.0.02,4]oct-5-en-4-ol?
The canonical SMILES for 3,8-dithiatricyclo[5.1.0.02,4]oct-5-en-4-ol is OC12C=CC3SC3C1S2.
What is the InChIKey of 3,8-dithiatricyclo[5.1.0.02,4]oct-5-en-4-ol?
The InChIKey is VUBOQPNQIMKEKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6OS2/c7-6-2-1-3-4(8-3)5(6)9-6/h1-5,7H.
What are the key properties of 3,8-dithiatricyclo[5.1.0.02,4]oct-5-en-4-ol?
3,8-dithiatricyclo[5.1.0.02,4]oct-5-en-4-ol has a molecular weight of 158.25 g/mol, XLogP of 0.84, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dithiatricyclo[5.1.0.02,4]oct-5-en-4-ol is sourced from PubChem (CID 87133539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).