About N'-(3-amino-3-chloropropyl)butane-1,4-diamine
N'-(3-amino-3-chloropropyl)butane-1,4-diamine (PubChem CID 87134007) has the molecular formula C7H18ClN3
and a molecular weight of 179.69 g/mol. Its IUPAC name is N'-(3-amino-3-chloropropyl)butane-1,4-diamine.
Molecular Properties
| Compound Name | N'-(3-amino-3-chloropropyl)butane-1,4-diamine |
| PubChem CID | 87134007 |
| Molecular Formula | C7H18ClN3 |
| Molecular Weight | 179.69 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | N'-(3-amino-3-chloropropyl)butane-1,4-diamine |
| SMILES | NCCCCNCCC(N)Cl |
| InChI | InChI=1S/C7H18ClN3/c8-7(10)3-6-11-5-2-1-4-9/h7,11H,1-6,9-10H2 |
| InChIKey | ANMOGBQDPDREMN-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.69 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-amino-3-chloropropyl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-amino-3-chloropropyl)butane-1,4-diamine?
The IUPAC name of N'-(3-amino-3-chloropropyl)butane-1,4-diamine (CID 87134007) is N'-(3-amino-3-chloropropyl)butane-1,4-diamine.
What is the SMILES notation for N'-(3-amino-3-chloropropyl)butane-1,4-diamine?
The canonical SMILES for N'-(3-amino-3-chloropropyl)butane-1,4-diamine is NCCCCNCCC(N)Cl.
What is the InChIKey of N'-(3-amino-3-chloropropyl)butane-1,4-diamine?
The InChIKey is ANMOGBQDPDREMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18ClN3/c8-7(10)3-6-11-5-2-1-4-9/h7,11H,1-6,9-10H2.
What are the key properties of N'-(3-amino-3-chloropropyl)butane-1,4-diamine?
N'-(3-amino-3-chloropropyl)butane-1,4-diamine has a molecular weight of 179.69 g/mol, XLogP of 0.23, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-amino-3-chloropropyl)butane-1,4-diamine is sourced from PubChem (CID 87134007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).