C24H17NO2 — CID 87134208
methyl 19-azapentacyclo[12.9.0.02,11.05,10.015,21]tricosa-1,3,5,7,10,12,14,16,18,20,22-undecaene-8-carboxylate (PubChem CID 87134208) has the molecular formula C24H17NO2 and a molecular weight of 351.41 g/mol. Its IUPAC name is methyl 19-azapentacyclo[12.9.0.02,11.05,10.015,21]tricosa-1,3,5,7,10,12,14,16,18,20,22-undecaene-8-carboxylate.
| Compound Name | methyl 19-azapentacyclo[12.9.0.02,11.05,10.015,21]tricosa-1,3,5,7,10,12,14,16,18,20,22-undecaene-8-carboxylate |
|---|---|
| PubChem CID | 87134208 |
| Molecular Formula | C24H17NO2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | methyl 19-azapentacyclo[12.9.0.02,11.05,10.015,21]tricosa-1,3,5,7,10,12,14,16,18,20,22-undecaene-8-carboxylate |
| SMILES | COC(=O)C1=CC=c2ccc3c(ccc4c5c(ccc43)=CN=CC=C5)c2C1 |
| InChI | InChI=1S/C24H17NO2/c1-27-24(26)16-5-4-15-6-8-21-20-9-7-17-14-25-12-2-3-18(17)19(20)10-11-22(21)23(15)13-16/h2-12,14H,13H2,1H3 |
| InChIKey | WSZFVKWTVGJCKR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|