About 6-prop-2-enoxyhexane-1,3-diamine
6-prop-2-enoxyhexane-1,3-diamine (PubChem CID 87134485) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is 6-prop-2-enoxyhexane-1,3-diamine.
Molecular Properties
| Compound Name | 6-prop-2-enoxyhexane-1,3-diamine |
| PubChem CID | 87134485 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 6-prop-2-enoxyhexane-1,3-diamine |
| SMILES | C=CCOCCCC(N)CCN |
| InChI | InChI=1S/C9H20N2O/c1-2-7-12-8-3-4-9(11)5-6-10/h2,9H,1,3-8,10-11H2 |
| InChIKey | KLZIUYVKTCNKPW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-prop-2-enoxyhexane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-prop-2-enoxyhexane-1,3-diamine?
The IUPAC name of 6-prop-2-enoxyhexane-1,3-diamine (CID 87134485) is 6-prop-2-enoxyhexane-1,3-diamine.
What is the SMILES notation for 6-prop-2-enoxyhexane-1,3-diamine?
The canonical SMILES for 6-prop-2-enoxyhexane-1,3-diamine is C=CCOCCCC(N)CCN.
What is the InChIKey of 6-prop-2-enoxyhexane-1,3-diamine?
The InChIKey is KLZIUYVKTCNKPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O/c1-2-7-12-8-3-4-9(11)5-6-10/h2,9H,1,3-8,10-11H2.
What are the key properties of 6-prop-2-enoxyhexane-1,3-diamine?
6-prop-2-enoxyhexane-1,3-diamine has a molecular weight of 172.27 g/mol, XLogP of 0.65, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-prop-2-enoxyhexane-1,3-diamine is sourced from PubChem (CID 87134485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).