About 2-aminoethanol;bis(dihydroxy(oxo)phosphanium)
2-aminoethanol;bis(dihydroxy(oxo)phosphanium) (PubChem CID 87134707) has the molecular formula C2H11NO7P2+2
and a molecular weight of 223.06 g/mol. Its IUPAC name is 2-aminoethanol;bis(dihydroxy(oxo)phosphanium).
Molecular Properties
| Compound Name | 2-aminoethanol;bis(dihydroxy(oxo)phosphanium) |
| PubChem CID | 87134707 |
| Molecular Formula | C2H11NO7P2+2 |
| Molecular Weight | 223.06 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 2-aminoethanol;bis(dihydroxy(oxo)phosphanium) |
| SMILES | NCCO.O=[P+](O)O.O=[P+](O)O |
| InChI | InChI=1S/C2H7NO.2HO3P/c3-1-2-4;2*1-4(2)3/h4H,1-3H2;2*(H-,1,2,3)/p+2 |
| InChIKey | WZSANDNVMKZFGJ-UHFFFAOYSA-P |
| XLogP | -1.81 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 223.06 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanol;bis(dihydroxy(oxo)phosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;bis(dihydroxy(oxo)phosphanium)?
The IUPAC name of 2-aminoethanol;bis(dihydroxy(oxo)phosphanium) (CID 87134707) is 2-aminoethanol;bis(dihydroxy(oxo)phosphanium).
What is the SMILES notation for 2-aminoethanol;bis(dihydroxy(oxo)phosphanium)?
The canonical SMILES for 2-aminoethanol;bis(dihydroxy(oxo)phosphanium) is NCCO.O=[P+](O)O.O=[P+](O)O.
What is the InChIKey of 2-aminoethanol;bis(dihydroxy(oxo)phosphanium)?
The InChIKey is WZSANDNVMKZFGJ-UHFFFAOYSA-P. The full InChI is InChI=1S/C2H7NO.2HO3P/c3-1-2-4;2*1-4(2)3/h4H,1-3H2;2*(H-,1,2,3)/p+2.
What are the key properties of 2-aminoethanol;bis(dihydroxy(oxo)phosphanium)?
2-aminoethanol;bis(dihydroxy(oxo)phosphanium) has a molecular weight of 223.06 g/mol, XLogP of -1.81, 1 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;bis(dihydroxy(oxo)phosphanium) is sourced from PubChem (CID 87134707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).