C8H10F8O — CID 87136906
1,1,2,2-tetrafluoro-4-(3,3,4,4-tetrafluorobutoxy)butane (PubChem CID 87136906) has the molecular formula C8H10F8O and a molecular weight of 274.15 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-(3,3,4,4-tetrafluorobutoxy)butane.
| Compound Name | 1,1,2,2-tetrafluoro-4-(3,3,4,4-tetrafluorobutoxy)butane |
|---|---|
| PubChem CID | 87136906 |
| Molecular Formula | C8H10F8O |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-(3,3,4,4-tetrafluorobutoxy)butane |
| SMILES | FC(F)C(F)(F)CCOCCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H10F8O/c9-5(10)7(13,14)1-3-17-4-2-8(15,16)6(11)12/h5-6H,1-4H2 |
| InChIKey | UBIOVRXEBPCVPU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|