C26H29F3N4O3 — CID 87136980
(2S,5R)-5-ethynyl-1-[2-[[1-[2-(2-oxopyrrolidin-1-yl)-4-(trifluoromethyl)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 87136980) has the molecular formula C26H29F3N4O3 and a molecular weight of 502.54 g/mol. Its IUPAC name is (2S,5R)-5-ethynyl-1-[2-[[1-[2-(2-oxopyrrolidin-1-yl)-4-(trifluoromethyl)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S,5R)-5-ethynyl-1-[2-[[1-[2-(2-oxopyrrolidin-1-yl)-4-(trifluoromethyl)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 87136980 |
| Molecular Formula | C26H29F3N4O3 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | (2S,5R)-5-ethynyl-1-[2-[[1-[2-(2-oxopyrrolidin-1-yl)-4-(trifluoromethyl)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | C#C[C@H]1CC[C@@H](C#N)N1C(=O)CNC1(Oc2ccc(C(F)(F)F)cc2N2CCCC2=O)CCCCC1 |
| InChI | InChI=1S/C26H29F3N4O3/c1-2-19-9-10-20(16-30)33(19)24(35)17-31-25(12-4-3-5-13-25)36-22-11-8-18(26(27,28)29)15-21(22)32-14-6-7-23(32)34/h1,8,11,15,19-20,31H,3-7,9-10,12-14,17H2/t19-,20-/m0/s1 |
| InChIKey | QHNISLDHCRAIBZ-PMACEKPBSA-N |
| XLogP | 3.98 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|