C21H24ClN3O2 — CID 87137066
(2S,5R)-1-[2-[[1-(4-chlorophenoxy)cyclohexyl]amino]acetyl]-5-ethynylpyrrolidine-2-carbonitrile (PubChem CID 87137066) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is (2S,5R)-1-[2-[[1-(4-chlorophenoxy)cyclohexyl]amino]acetyl]-5-ethynylpyrrolidine-2-carbonitrile.
| Compound Name | (2S,5R)-1-[2-[[1-(4-chlorophenoxy)cyclohexyl]amino]acetyl]-5-ethynylpyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 87137066 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | (2S,5R)-1-[2-[[1-(4-chlorophenoxy)cyclohexyl]amino]acetyl]-5-ethynylpyrrolidine-2-carbonitrile |
| SMILES | C#C[C@H]1CC[C@@H](C#N)N1C(=O)CNC1(Oc2ccc(Cl)cc2)CCCCC1 |
| InChI | InChI=1S/C21H24ClN3O2/c1-2-17-8-9-18(14-23)25(17)20(26)15-24-21(12-4-3-5-13-21)27-19-10-6-16(22)7-11-19/h1,6-7,10-11,17-18,24H,3-5,8-9,12-13,15H2/t17-,18-/m0/s1 |
| InChIKey | GFFLHDOMINUYKQ-ROUUACIJSA-N |
| XLogP | 3.49 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|