C15H23F6N3O3 — CID 87137127
1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazol-3-yl]-3-(2-methylheptan-3-yl)urea (PubChem CID 87137127) has the molecular formula C15H23F6N3O3 and a molecular weight of 407.36 g/mol. Its IUPAC name is 1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazol-3-yl]-3-(2-methylheptan-3-yl)urea.
| Compound Name | 1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazol-3-yl]-3-(2-methylheptan-3-yl)urea |
|---|---|
| PubChem CID | 87137127 |
| Molecular Formula | C15H23F6N3O3 |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazol-3-yl]-3-(2-methylheptan-3-yl)urea |
| SMILES | CCCCC(NC(=O)NC1=NOC(C(O)(C(F)(F)F)C(F)(F)F)C1)C(C)C |
| InChI | InChI=1S/C15H23F6N3O3/c1-4-5-6-9(8(2)3)22-12(25)23-11-7-10(27-24-11)13(26,14(16,17)18)15(19,20)21/h8-10,26H,4-7H2,1-3H3,(H2,22,23,24,25) |
| InChIKey | CZLGORIRBHOEJR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |