C16H21Cl2N3O2 — CID 87137565
(1R,6S)-1-tert-butyl-8-(5,6-dichloro-3-pyridinyl)-3,8-diazabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 87137565) has the molecular formula C16H21Cl2N3O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is (1R,6S)-1-tert-butyl-8-(5,6-dichloro-3-pyridinyl)-3,8-diazabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (1R,6S)-1-tert-butyl-8-(5,6-dichloro-3-pyridinyl)-3,8-diazabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 87137565 |
| Molecular Formula | C16H21Cl2N3O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (1R,6S)-1-tert-butyl-8-(5,6-dichloro-3-pyridinyl)-3,8-diazabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | CC(C)(C)[C@@]12CN(C(=O)O)CC[C@H]1CN2c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H21Cl2N3O2/c1-15(2,3)16-9-20(14(22)23)5-4-10(16)8-21(16)11-6-12(17)13(18)19-7-11/h6-7,10H,4-5,8-9H2,1-3H3,(H,22,23)/t10-,16+/m0/s1 |
| InChIKey | QJHFRBXQMRXYGA-MGPLVRAMSA-N |
| XLogP | 3.99 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|