C11H13Cl2N3 — CID 87137939
(3aS,6aR)-5-(5,6-dichloro-3-pyridinyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 87137939) has the molecular formula C11H13Cl2N3 and a molecular weight of 258.15 g/mol. Its IUPAC name is (3aS,6aR)-5-(5,6-dichloro-3-pyridinyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aS,6aR)-5-(5,6-dichloro-3-pyridinyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 87137939 |
| Molecular Formula | C11H13Cl2N3 |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (3aS,6aR)-5-(5,6-dichloro-3-pyridinyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | Clc1cc(N2C[C@H]3CNC[C@H]3C2)cnc1Cl |
| InChI | InChI=1S/C11H13Cl2N3/c12-10-1-9(4-15-11(10)13)16-5-7-2-14-3-8(7)6-16/h1,4,7-8,14H,2-3,5-6H2/t7-,8+ |
| InChIKey | CWUSSMOAVKKWJU-OCAPTIKFSA-N |
| XLogP | 2.04 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|