C16H19F3N2O — CID 87137954
1-[(3aR,6aR)-1-[(1R)-1-phenylethyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-5-yl]-2,2,2-trifluoroethanone (PubChem CID 87137954) has the molecular formula C16H19F3N2O and a molecular weight of 312.33 g/mol. Its IUPAC name is 1-[(3aR,6aR)-1-[(1R)-1-phenylethyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-5-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(3aR,6aR)-1-[(1R)-1-phenylethyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-5-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 87137954 |
| Molecular Formula | C16H19F3N2O |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-[(3aR,6aR)-1-[(1R)-1-phenylethyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-5-yl]-2,2,2-trifluoroethanone |
| SMILES | C[C@H](c1ccccc1)N1CC[C@@H]2CN(C(=O)C(F)(F)F)C[C@@H]21 |
| InChI | InChI=1S/C16H19F3N2O/c1-11(12-5-3-2-4-6-12)21-8-7-13-9-20(10-14(13)21)15(22)16(17,18)19/h2-6,11,13-14H,7-10H2,1H3/t11-,13-,14+/m1/s1 |
| InChIKey | JNEJHGZIUNFUBG-BNOWGMLFSA-N |
| XLogP | 2.84 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |