About 3-hydroxy-2-methylbenzaldehyde;phenol
3-hydroxy-2-methylbenzaldehyde;phenol (PubChem CID 87138330) has the molecular formula C14H14O3
and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-hydroxy-2-methylbenzaldehyde;phenol.
Molecular Properties
| Compound Name | 3-hydroxy-2-methylbenzaldehyde;phenol |
| PubChem CID | 87138330 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3-hydroxy-2-methylbenzaldehyde;phenol |
| SMILES | Cc1c(O)cccc1C=O.Oc1ccccc1 |
| InChI | InChI=1S/C8H8O2.C6H6O/c1-6-7(5-9)3-2-4-8(6)10;7-6-4-2-1-3-5-6/h2-5,10H,1H3;1-5,7H |
| InChIKey | YZYBFQZZOJRMSH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-2-methylbenzaldehyde;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-methylbenzaldehyde;phenol?
The IUPAC name of 3-hydroxy-2-methylbenzaldehyde;phenol (CID 87138330) is 3-hydroxy-2-methylbenzaldehyde;phenol.
What is the SMILES notation for 3-hydroxy-2-methylbenzaldehyde;phenol?
The canonical SMILES for 3-hydroxy-2-methylbenzaldehyde;phenol is Cc1c(O)cccc1C=O.Oc1ccccc1.
What is the InChIKey of 3-hydroxy-2-methylbenzaldehyde;phenol?
The InChIKey is YZYBFQZZOJRMSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C6H6O/c1-6-7(5-9)3-2-4-8(6)10;7-6-4-2-1-3-5-6/h2-5,10H,1H3;1-5,7H.
What are the key properties of 3-hydroxy-2-methylbenzaldehyde;phenol?
3-hydroxy-2-methylbenzaldehyde;phenol has a molecular weight of 230.26 g/mol, XLogP of 2.91, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-methylbenzaldehyde;phenol is sourced from PubChem (CID 87138330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).