C34H48F5NO5SSi — CID 87138992
2-[(3R,6R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-6-yl]acetic acid (PubChem CID 87138992) has the molecular formula C34H48F5NO5SSi and a molecular weight of 705.90 g/mol. Its IUPAC name is 2-[(3R,6R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-6-yl]acetic acid.
| Compound Name | 2-[(3R,6R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-6-yl]acetic acid |
|---|---|
| PubChem CID | 87138992 |
| Molecular Formula | C34H48F5NO5SSi |
| Molecular Weight | 705.90 g/mol |
| Exact Mass | 705.29 |
| IUPAC Name | 2-[(3R,6R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-6-yl]acetic acid |
| SMILES | CC(C)c1nc2c(c3c1[C@@H](c1ccc(S(F)(F)(F)(F)F)cc1)OC31CCOCC1)[C@@H](O[Si](C)(C)C(C)(C)C)CC(C)(C)[C@H]2CC(=O)O |
| InChI | InChI=1S/C34H48F5NO5SSi/c1-20(2)29-27-28(26-24(45-47(8,9)32(3,4)5)19-33(6,7)23(18-25(41)42)30(26)40-29)34(14-16-43-17-15-34)44-31(27)21-10-12-22(13-11-21)46(35,36,37,38)39/h10-13,20,23-24,31H,14-19H2,1-9H3,(H,41,42)/t23-,24-,31+/m0/s1 |
| InChIKey | NUQIOGJIOBIRNF-ISTJGCCRSA-N |
| XLogP | 11.04 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.90 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|