C18H15ClF3NO3S — CID 87139257
[1-(4-chlorophenyl)-9-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-5-yl] trifluoromethanesulfonate (PubChem CID 87139257) has the molecular formula C18H15ClF3NO3S and a molecular weight of 417.84 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-9-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-5-yl] trifluoromethanesulfonate.
| Compound Name | [1-(4-chlorophenyl)-9-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87139257 |
| Molecular Formula | C18H15ClF3NO3S |
| Molecular Weight | 417.84 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | [1-(4-chlorophenyl)-9-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-5-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)CN1CCC2(c2ccc(Cl)cc2)C1)C(F)(F)F |
| InChI | InChI=1S/C18H15ClF3NO3S/c19-14-3-1-13(2-4-14)17-7-8-23(11-17)10-12-9-15(5-6-16(12)17)26-27(24,25)18(20,21)22/h1-6,9H,7-8,10-11H2 |
| InChIKey | ZJUXIHQYSGMYGI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.84 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|