About 6-bromo-7-methyl-5H-[1,2,4]triazolo[1,5-c]pyrimidine
6-bromo-7-methyl-5H-[1,2,4]triazolo[1,5-c]pyrimidine (PubChem CID 87139281) has the molecular formula C6H7BrN4
and a molecular weight of 215.05 g/mol. Its IUPAC name is 6-bromo-7-methyl-5H-[1,2,4]triazolo[1,5-c]pyrimidine.
Molecular Properties
| Compound Name | 6-bromo-7-methyl-5H-[1,2,4]triazolo[1,5-c]pyrimidine |
| PubChem CID | 87139281 |
| Molecular Formula | C6H7BrN4 |
| Molecular Weight | 215.05 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | 6-bromo-7-methyl-5H-[1,2,4]triazolo[1,5-c]pyrimidine |
| SMILES | CC1=Cc2ncnn2CN1Br |
| InChI | InChI=1S/C6H7BrN4/c1-5-2-6-8-3-9-11(6)4-10(5)7/h2-3H,4H2,1H3 |
| InChIKey | WXDSWOXNYANWRX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.05 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-7-methyl-5H-[1,2,4]triazolo[1,5-c]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-7-methyl-5H-[1,2,4]triazolo[1,5-c]pyrimidine?
The IUPAC name of 6-bromo-7-methyl-5H-[1,2,4]triazolo[1,5-c]pyrimidine (CID 87139281) is 6-bromo-7-methyl-5H-[1,2,4]triazolo[1,5-c]pyrimidine.
What is the SMILES notation for 6-bromo-7-methyl-5H-[1,2,4]triazolo[1,5-c]pyrimidine?
The canonical SMILES for 6-bromo-7-methyl-5H-[1,2,4]triazolo[1,5-c]pyrimidine is CC1=Cc2ncnn2CN1Br.
What is the InChIKey of 6-bromo-7-methyl-5H-[1,2,4]triazolo[1,5-c]pyrimidine?
The InChIKey is WXDSWOXNYANWRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrN4/c1-5-2-6-8-3-9-11(6)4-10(5)7/h2-3H,4H2,1H3.
What are the key properties of 6-bromo-7-methyl-5H-[1,2,4]triazolo[1,5-c]pyrimidine?
6-bromo-7-methyl-5H-[1,2,4]triazolo[1,5-c]pyrimidine has a molecular weight of 215.05 g/mol, XLogP of 1.22, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-7-methyl-5H-[1,2,4]triazolo[1,5-c]pyrimidine is sourced from PubChem (CID 87139281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).