C19H16Cl2F3NO3S — CID 87139294
[1-(3,4-dichlorophenyl)-9-azatricyclo[7.2.2.02,7]trideca-2(7),3,5-trien-5-yl] trifluoromethanesulfonate (PubChem CID 87139294) has the molecular formula C19H16Cl2F3NO3S and a molecular weight of 466.31 g/mol. Its IUPAC name is [1-(3,4-dichlorophenyl)-9-azatricyclo[7.2.2.02,7]trideca-2(7),3,5-trien-5-yl] trifluoromethanesulfonate.
| Compound Name | [1-(3,4-dichlorophenyl)-9-azatricyclo[7.2.2.02,7]trideca-2(7),3,5-trien-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87139294 |
| Molecular Formula | C19H16Cl2F3NO3S |
| Molecular Weight | 466.31 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | [1-(3,4-dichlorophenyl)-9-azatricyclo[7.2.2.02,7]trideca-2(7),3,5-trien-5-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)CN1CCC2(c2ccc(Cl)c(Cl)c2)CC1)C(F)(F)F |
| InChI | InChI=1S/C19H16Cl2F3NO3S/c20-16-4-1-13(10-17(16)21)18-5-7-25(8-6-18)11-12-9-14(2-3-15(12)18)28-29(26,27)19(22,23)24/h1-4,9-10H,5-8,11H2 |
| InChIKey | FTDQNRPGSABRHL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.31 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|