About copper;fluoroform
copper;fluoroform (PubChem CID 87139424) has the molecular formula CHCuF3
and a molecular weight of 133.56 g/mol. Its IUPAC name is copper;fluoroform.
Molecular Properties
| Compound Name | copper;fluoroform |
| PubChem CID | 87139424 |
| Molecular Formula | CHCuF3 |
| Molecular Weight | 133.56 g/mol |
| Exact Mass | 132.93 |
| IUPAC Name | copper;fluoroform |
| SMILES | FC(F)F.[Cu] |
| InChI | InChI=1S/CHF3.Cu/c2-1(3)4;/h1H; |
| InChIKey | ZPRHQLWNFPSPKD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.56 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze copper;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;fluoroform?
The IUPAC name of copper;fluoroform (CID 87139424) is copper;fluoroform.
What is the SMILES notation for copper;fluoroform?
The canonical SMILES for copper;fluoroform is FC(F)F.[Cu].
What is the InChIKey of copper;fluoroform?
The InChIKey is ZPRHQLWNFPSPKD-UHFFFAOYSA-N. The full InChI is InChI=1S/CHF3.Cu/c2-1(3)4;/h1H;.
What are the key properties of copper;fluoroform?
copper;fluoroform has a molecular weight of 133.56 g/mol, XLogP of 1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for copper;fluoroform is sourced from PubChem (CID 87139424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).