C24H31ClFNO5 — CID 87139508
2-[10-[(2-chloro-5-fluoro-3-pyridinyl)oxy]decyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 87139508) has the molecular formula C24H31ClFNO5 and a molecular weight of 467.97 g/mol. Its IUPAC name is 2-[10-[(2-chloro-5-fluoro-3-pyridinyl)oxy]decyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[10-[(2-chloro-5-fluoro-3-pyridinyl)oxy]decyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 87139508 |
| Molecular Formula | C24H31ClFNO5 |
| Molecular Weight | 467.97 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 2-[10-[(2-chloro-5-fluoro-3-pyridinyl)oxy]decyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(CCCCCCCCCCOc2cc(F)cnc2Cl)=C(C)C1=O |
| InChI | InChI=1S/C24H31ClFNO5/c1-16-18(21(29)23(31-3)22(30-2)20(16)28)12-10-8-6-4-5-7-9-11-13-32-19-14-17(26)15-27-24(19)25/h14-15H,4-13H2,1-3H3 |
| InChIKey | ICZKWCYZECRMHK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.97 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|