C23H48O6 — CID 87139616
2,3-dihydroxypropyl octadecanoate;ethane-1,2-diol (PubChem CID 87139616) has the molecular formula C23H48O6 and a molecular weight of 420.63 g/mol. Its IUPAC name is 2,3-dihydroxypropyl octadecanoate;ethane-1,2-diol.
| Compound Name | 2,3-dihydroxypropyl octadecanoate;ethane-1,2-diol |
|---|---|
| PubChem CID | 87139616 |
| Molecular Formula | C23H48O6 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.35 |
| IUPAC Name | 2,3-dihydroxypropyl octadecanoate;ethane-1,2-diol |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO.OCCO |
| InChI | InChI=1S/C21H42O4.C2H6O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22;3-1-2-4/h20,22-23H,2-19H2,1H3;3-4H,1-2H2 |
| InChIKey | DDGNGQLUEBQQGS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|