C18H21N3O3 — CID 871407
N-[(2,4-dimethoxyphenyl)methylideneamino]-2-(4-methylanilino)acetamide (PubChem CID 871407) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methylideneamino]-2-(4-methylanilino)acetamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methylideneamino]-2-(4-methylanilino)acetamide |
|---|---|
| PubChem CID | 871407 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methylideneamino]-2-(4-methylanilino)acetamide |
| SMILES | COc1ccc(C=NNC(=O)CNc2ccc(C)cc2)c(OC)c1 |
| InChI | InChI=1S/C18H21N3O3/c1-13-4-7-15(8-5-13)19-12-18(22)21-20-11-14-6-9-16(23-2)10-17(14)24-3/h4-11,19H,12H2,1-3H3,(H,21,22) |
| InChIKey | PUFBHGZBWGVLNK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|