About 9-(benzenesulfonyl)-2-chloro-6-[2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole
9-(benzenesulfonyl)-2-chloro-6-[2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole (PubChem CID 87141046) has the molecular formula C26H19ClN2O3S
and a molecular weight of 474.97 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-2-chloro-6-[2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 9-(benzenesulfonyl)-2-chloro-6-[2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole |
| PubChem CID | 87141046 |
| Molecular Formula | C26H19ClN2O3S |
| Molecular Weight | 474.97 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 9-(benzenesulfonyl)-2-chloro-6-[2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole |
| SMILES | COc1ccc(C=Cc2ccc3c(c2)c2ccc(Cl)nc2n3S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H19ClN2O3S/c1-32-20-12-9-18(10-13-20)7-8-19-11-15-24-23(17-19)22-14-16-25(27)28-26(22)29(24)33(30,31)21-5-3-2-4-6-21/h2-17H,1H3 |
| InChIKey | FOMIIBUZODMIDH-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.97 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 9-(benzenesulfonyl)-2-chloro-6-[2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(benzenesulfonyl)-2-chloro-6-[2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole?
The IUPAC name of 9-(benzenesulfonyl)-2-chloro-6-[2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole (CID 87141046) is 9-(benzenesulfonyl)-2-chloro-6-[2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole.
What is the SMILES notation for 9-(benzenesulfonyl)-2-chloro-6-[2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole?
The canonical SMILES for 9-(benzenesulfonyl)-2-chloro-6-[2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole is COc1ccc(C=Cc2ccc3c(c2)c2ccc(Cl)nc2n3S(=O)(=O)c2ccccc2)cc1.
What is the InChIKey of 9-(benzenesulfonyl)-2-chloro-6-[2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole?
The InChIKey is FOMIIBUZODMIDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19ClN2O3S/c1-32-20-12-9-18(10-13-20)7-8-19-11-15-24-23(17-19)22-14-16-25(27)28-26(22)29(24)33(30,31)21-5-3-2-4-6-21/h2-17H,1H3.
What are the key properties of 9-(benzenesulfonyl)-2-chloro-6-[2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole?
9-(benzenesulfonyl)-2-chloro-6-[2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole has a molecular weight of 474.97 g/mol, XLogP of 6.26, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(benzenesulfonyl)-2-chloro-6-[2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole is sourced from PubChem (CID 87141046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).