About chloroethene;2-methylprop-1-ene
chloroethene;2-methylprop-1-ene (PubChem CID 87141348) has the molecular formula C6H11Cl
and a molecular weight of 118.61 g/mol. Its IUPAC name is chloroethene;2-methylprop-1-ene.
Molecular Properties
| Compound Name | chloroethene;2-methylprop-1-ene |
| PubChem CID | 87141348 |
| Molecular Formula | C6H11Cl |
| Molecular Weight | 118.61 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | chloroethene;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=CCl |
| InChI | InChI=1S/C4H8.C2H3Cl/c1-4(2)3;1-2-3/h1H2,2-3H3;2H,1H2 |
| InChIKey | ANFGXIRXYUIHJM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze chloroethene;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroethene;2-methylprop-1-ene?
The IUPAC name of chloroethene;2-methylprop-1-ene (CID 87141348) is chloroethene;2-methylprop-1-ene.
What is the SMILES notation for chloroethene;2-methylprop-1-ene?
The canonical SMILES for chloroethene;2-methylprop-1-ene is C=C(C)C.C=CCl.
What is the InChIKey of chloroethene;2-methylprop-1-ene?
The InChIKey is ANFGXIRXYUIHJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8.C2H3Cl/c1-4(2)3;1-2-3/h1H2,2-3H3;2H,1H2.
What are the key properties of chloroethene;2-methylprop-1-ene?
chloroethene;2-methylprop-1-ene has a molecular weight of 118.61 g/mol, XLogP of 2.95, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloroethene;2-methylprop-1-ene is sourced from PubChem (CID 87141348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).