C21H21F2NO2 — CID 87141692
4-[4-butyl-2-(oxiran-2-yl)phenyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 87141692) has the molecular formula C21H21F2NO2 and a molecular weight of 357.40 g/mol. Its IUPAC name is 4-[4-butyl-2-(oxiran-2-yl)phenyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-[4-butyl-2-(oxiran-2-yl)phenyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 87141692 |
| Molecular Formula | C21H21F2NO2 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 4-[4-butyl-2-(oxiran-2-yl)phenyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCc1ccc(C2COC(c3c(F)cccc3F)=N2)c(C2CO2)c1 |
| InChI | InChI=1S/C21H21F2NO2/c1-2-3-5-13-8-9-14(15(10-13)19-12-25-19)18-11-26-21(24-18)20-16(22)6-4-7-17(20)23/h4,6-10,18-19H,2-3,5,11-12H2,1H3 |
| InChIKey | CSZQIKVAVMFSNG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|