C11H11F5N2O4S — CID 87142197
3-(methanesulfonamido)-2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)benzamide (PubChem CID 87142197) has the molecular formula C11H11F5N2O4S and a molecular weight of 362.28 g/mol. Its IUPAC name is 3-(methanesulfonamido)-2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)benzamide.
| Compound Name | 3-(methanesulfonamido)-2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)benzamide |
|---|---|
| PubChem CID | 87142197 |
| Molecular Formula | C11H11F5N2O4S |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 3-(methanesulfonamido)-2-methoxy-5-(1,1,2,2,2-pentafluoroethyl)benzamide |
| SMILES | COc1c(NS(C)(=O)=O)cc(C(F)(F)C(F)(F)F)cc1C(N)=O |
| InChI | InChI=1S/C11H11F5N2O4S/c1-22-8-6(9(17)19)3-5(10(12,13)11(14,15)16)4-7(8)18-23(2,20)21/h3-4,18H,1-2H3,(H2,17,19) |
| InChIKey | MDISOSSSGUCNIO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|