C17H18F3NO6S — CID 87142988
methyl 1-(3-oxobutanoyl)-4-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxylate (PubChem CID 87142988) has the molecular formula C17H18F3NO6S and a molecular weight of 421.39 g/mol. Its IUPAC name is methyl 1-(3-oxobutanoyl)-4-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(3-oxobutanoyl)-4-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 87142988 |
| Molecular Formula | C17H18F3NO6S |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | methyl 1-(3-oxobutanoyl)-4-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(S(=O)(=O)c2ccccc2C(F)(F)F)CN1C(=O)CC(C)=O |
| InChI | InChI=1S/C17H18F3NO6S/c1-10(22)7-15(23)21-9-11(8-13(21)16(24)27-2)28(25,26)14-6-4-3-5-12(14)17(18,19)20/h3-6,11,13H,7-9H2,1-2H3 |
| InChIKey | SGNBAXPADSYIBL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|