About 2-bromo-4-[tetrafluoro(3,3,3-trifluoropropyl)-λ6-sulfanyl]aniline
2-bromo-4-[tetrafluoro(3,3,3-trifluoropropyl)-λ6-sulfanyl]aniline (PubChem CID 87143122) has the molecular formula C9H9BrF7NS
and a molecular weight of 376.14 g/mol. Its IUPAC name is 2-bromo-4-[tetrafluoro(3,3,3-trifluoropropyl)-λ6-sulfanyl]aniline.
Molecular Properties
| Compound Name | 2-bromo-4-[tetrafluoro(3,3,3-trifluoropropyl)-λ6-sulfanyl]aniline |
| PubChem CID | 87143122 |
| Molecular Formula | C9H9BrF7NS |
| Molecular Weight | 376.14 g/mol |
| Exact Mass | 374.95 |
| IUPAC Name | 2-bromo-4-[tetrafluoro(3,3,3-trifluoropropyl)-λ6-sulfanyl]aniline |
| SMILES | Nc1ccc(S(F)(F)(F)(F)CCC(F)(F)F)cc1Br |
| InChI | InChI=1S/C9H9BrF7NS/c10-7-5-6(1-2-8(7)18)19(14,15,16,17)4-3-9(11,12)13/h1-2,5H,3-4,18H2 |
| InChIKey | SRGLGXQMIXTHEM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.14 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-[tetrafluoro(3,3,3-trifluoropropyl)-λ6-sulfanyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-[tetrafluoro(3,3,3-trifluoropropyl)-λ6-sulfanyl]aniline?
The IUPAC name of 2-bromo-4-[tetrafluoro(3,3,3-trifluoropropyl)-λ6-sulfanyl]aniline (CID 87143122) is 2-bromo-4-[tetrafluoro(3,3,3-trifluoropropyl)-λ6-sulfanyl]aniline.
What is the SMILES notation for 2-bromo-4-[tetrafluoro(3,3,3-trifluoropropyl)-λ6-sulfanyl]aniline?
The canonical SMILES for 2-bromo-4-[tetrafluoro(3,3,3-trifluoropropyl)-λ6-sulfanyl]aniline is Nc1ccc(S(F)(F)(F)(F)CCC(F)(F)F)cc1Br.
What is the InChIKey of 2-bromo-4-[tetrafluoro(3,3,3-trifluoropropyl)-λ6-sulfanyl]aniline?
The InChIKey is SRGLGXQMIXTHEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrF7NS/c10-7-5-6(1-2-8(7)18)19(14,15,16,17)4-3-9(11,12)13/h1-2,5H,3-4,18H2.
What are the key properties of 2-bromo-4-[tetrafluoro(3,3,3-trifluoropropyl)-λ6-sulfanyl]aniline?
2-bromo-4-[tetrafluoro(3,3,3-trifluoropropyl)-λ6-sulfanyl]aniline has a molecular weight of 376.14 g/mol, XLogP of 5.76, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-[tetrafluoro(3,3,3-trifluoropropyl)-λ6-sulfanyl]aniline is sourced from PubChem (CID 87143122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).