C19H21F4N3O4S — CID 87143505
ethyl 2-[4-[methyl-(2,3,4,6-tetrafluoro-5-methylphenyl)sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]acetate (PubChem CID 87143505) has the molecular formula C19H21F4N3O4S and a molecular weight of 463.45 g/mol. Its IUPAC name is ethyl 2-[4-[methyl-(2,3,4,6-tetrafluoro-5-methylphenyl)sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]acetate.
| Compound Name | ethyl 2-[4-[methyl-(2,3,4,6-tetrafluoro-5-methylphenyl)sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]acetate |
|---|---|
| PubChem CID | 87143505 |
| Molecular Formula | C19H21F4N3O4S |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | ethyl 2-[4-[methyl-(2,3,4,6-tetrafluoro-5-methylphenyl)sulfonylamino]-4,5,6,7-tetrahydroindazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1ncc2c1CCCC2N(C)S(=O)(=O)c1c(F)c(C)c(F)c(F)c1F |
| InChI | InChI=1S/C19H21F4N3O4S/c1-4-30-14(27)9-26-13-7-5-6-12(11(13)8-24-26)25(3)31(28,29)19-16(21)10(2)15(20)17(22)18(19)23/h8,12H,4-7,9H2,1-3H3 |
| InChIKey | AVYGEZVDOZIBLN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|