About CID 87143780
CID 87143780 (PubChem CID 87143780) has the molecular formula C10H18F4Si2
and a molecular weight of 270.42 g/mol.
Molecular Properties
| Compound Name | CID 87143780 |
| PubChem CID | 87143780 |
| Molecular Formula | C10H18F4Si2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | — |
| SMILES | FC(F)CCC[Si]CC[Si]CCCC(F)F |
| InChI | InChI=1S/C10H18F4Si2/c11-9(12)3-1-5-15-7-8-16-6-2-4-10(13)14/h9-10H,1-8H2 |
| InChIKey | QALPUPXUODHJSR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87143780 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87143780?
The IUPAC name of CID 87143780 (CID 87143780) is not available.
What is the SMILES notation for CID 87143780?
The canonical SMILES for CID 87143780 is FC(F)CCC[Si]CC[Si]CCCC(F)F.
What is the InChIKey of CID 87143780?
The InChIKey is QALPUPXUODHJSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F4Si2/c11-9(12)3-1-5-15-7-8-16-6-2-4-10(13)14/h9-10H,1-8H2.
What are the key properties of CID 87143780?
CID 87143780 has a molecular weight of 270.42 g/mol, XLogP of 4.16, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87143780 is sourced from PubChem (CID 87143780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).