C26H27F6NO4 — CID 87144437
(3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid (PubChem CID 87144437) has the molecular formula C26H27F6NO4 and a molecular weight of 531.49 g/mol. Its IUPAC name is (3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid.
| Compound Name | (3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid |
|---|---|
| PubChem CID | 87144437 |
| Molecular Formula | C26H27F6NO4 |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | (3aR,4R,5S,7aS)-5-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyethoxy]-4-(2-methylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid |
| SMILES | Cc1ccccc1[C@H]1[C@@H]2CN(C(=O)O)C[C@H]2CC[C@@H]1O[C@H](CO)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H27F6NO4/c1-14-4-2-3-5-19(14)23-20-12-33(24(35)36)11-15(20)6-7-21(23)37-22(13-34)16-8-17(25(27,28)29)10-18(9-16)26(30,31)32/h2-5,8-10,15,20-23,34H,6-7,11-13H2,1H3,(H,35,36)/t15-,20-,21+,22-,23+/m1/s1 |
| InChIKey | PHNXPEQNWACTRW-PZTYSZJPSA-N |
| XLogP | 6.25 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |