About 2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl propanoate
2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl propanoate (PubChem CID 871445) has the molecular formula C13H12N2O6
and a molecular weight of 292.25 g/mol. Its IUPAC name is 2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl propanoate.
Molecular Properties
| Compound Name | 2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl propanoate |
| PubChem CID | 871445 |
| Molecular Formula | C13H12N2O6 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl propanoate |
| SMILES | CCC(=O)OCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C13H12N2O6/c1-2-11(16)21-6-5-14-12(17)9-4-3-8(15(19)20)7-10(9)13(14)18/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | HORVQOMOHYPQFC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl propanoate?
The IUPAC name of 2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl propanoate (CID 871445) is 2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl propanoate.
What is the SMILES notation for 2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl propanoate?
The canonical SMILES for 2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl propanoate is CCC(=O)OCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O.
What is the InChIKey of 2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl propanoate?
The InChIKey is HORVQOMOHYPQFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O6/c1-2-11(16)21-6-5-14-12(17)9-4-3-8(15(19)20)7-10(9)13(14)18/h3-4,7H,2,5-6H2,1H3.
What are the key properties of 2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl propanoate?
2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl propanoate has a molecular weight of 292.25 g/mol, XLogP of 1.14, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-nitro-1,3-dioxoisoindol-2-yl)ethyl propanoate is sourced from PubChem (CID 871445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).