C12H24N10O6S2 — CID 87145279
N-(1,3-dihydrazinyl-1,3-dioxopropan-2-yl)-3-[[3-[(1,3-dihydrazinyl-1,3-dioxopropan-2-yl)amino]-3-oxopropyl]disulfanyl]propanamide (PubChem CID 87145279) has the molecular formula C12H24N10O6S2 and a molecular weight of 468.52 g/mol. Its IUPAC name is N-(1,3-dihydrazinyl-1,3-dioxopropan-2-yl)-3-[[3-[(1,3-dihydrazinyl-1,3-dioxopropan-2-yl)amino]-3-oxopropyl]disulfanyl]propanamide.
| Compound Name | N-(1,3-dihydrazinyl-1,3-dioxopropan-2-yl)-3-[[3-[(1,3-dihydrazinyl-1,3-dioxopropan-2-yl)amino]-3-oxopropyl]disulfanyl]propanamide |
|---|---|
| PubChem CID | 87145279 |
| Molecular Formula | C12H24N10O6S2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | N-(1,3-dihydrazinyl-1,3-dioxopropan-2-yl)-3-[[3-[(1,3-dihydrazinyl-1,3-dioxopropan-2-yl)amino]-3-oxopropyl]disulfanyl]propanamide |
| SMILES | NNC(=O)C(NC(=O)CCSSCCC(=O)NC(C(=O)NN)C(=O)NN)C(=O)NN |
| InChI | InChI=1S/C12H24N10O6S2/c13-19-9(25)7(10(26)20-14)17-5(23)1-3-29-30-4-2-6(24)18-8(11(27)21-15)12(28)22-16/h7-8H,1-4,13-16H2,(H,17,23)(H,18,24)(H,19,25)(H,20,26)(H,21,27)(H,22,28) |
| InChIKey | NCCFYSDJGDNAHW-UHFFFAOYSA-N |
| XLogP | -5.92 |
| TPSA | 278.68 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | -5.92 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|