C21H20N3O4+ — CID 87145529
1,3-dioxolan-2-yl-[(6,11-dioxo-3H-naphtho[2,3-e]benzimidazol-2-yl)methyl]-dimethylazanium (PubChem CID 87145529) has the molecular formula C21H20N3O4+ and a molecular weight of 378.41 g/mol. Its IUPAC name is 1,3-dioxolan-2-yl-[(6,11-dioxo-3H-naphtho[2,3-e]benzimidazol-2-yl)methyl]-dimethylazanium.
| Compound Name | 1,3-dioxolan-2-yl-[(6,11-dioxo-3H-naphtho[2,3-e]benzimidazol-2-yl)methyl]-dimethylazanium |
|---|---|
| PubChem CID | 87145529 |
| Molecular Formula | C21H20N3O4+ |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1,3-dioxolan-2-yl-[(6,11-dioxo-3H-naphtho[2,3-e]benzimidazol-2-yl)methyl]-dimethylazanium |
| SMILES | C[N+](C)(Cc1nc2c3c(ccc2[nH]1)C(=O)c1ccccc1C3=O)C1OCCO1 |
| InChI | InChI=1S/C21H19N3O4/c1-24(2,21-27-9-10-28-21)11-16-22-15-8-7-14-17(18(15)23-16)20(26)13-6-4-3-5-12(13)19(14)25/h3-8,21H,9-11H2,1-2H3/p+1 |
| InChIKey | FJSZVUJLEHSMJM-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|