About 4-[[1-(2,5-dioxopyrrolidin-1-yl)-5-nitro-2H-pyridin-2-yl]disulfanyl]-4-methylpentanoic acid
4-[[1-(2,5-dioxopyrrolidin-1-yl)-5-nitro-2H-pyridin-2-yl]disulfanyl]-4-methylpentanoic acid (PubChem CID 87146001) has the molecular formula C15H19N3O6S2
and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-[[1-(2,5-dioxopyrrolidin-1-yl)-5-nitro-2H-pyridin-2-yl]disulfanyl]-4-methylpentanoic acid.
Molecular Properties
| Compound Name | 4-[[1-(2,5-dioxopyrrolidin-1-yl)-5-nitro-2H-pyridin-2-yl]disulfanyl]-4-methylpentanoic acid |
| PubChem CID | 87146001 |
| Molecular Formula | C15H19N3O6S2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 4-[[1-(2,5-dioxopyrrolidin-1-yl)-5-nitro-2H-pyridin-2-yl]disulfanyl]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)SSC1C=CC([N+](=O)[O-])=CN1N1C(=O)CCC1=O |
| InChI | InChI=1S/C15H19N3O6S2/c1-15(2,8-7-14(21)22)26-25-13-6-3-10(18(23)24)9-16(13)17-11(19)4-5-12(17)20/h3,6,9,13H,4-5,7-8H2,1-2H3,(H,21,22) |
| InChIKey | OSKXOJDBDXGORR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 121.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[[1-(2,5-dioxopyrrolidin-1-yl)-5-nitro-2H-pyridin-2-yl]disulfanyl]-4-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-(2,5-dioxopyrrolidin-1-yl)-5-nitro-2H-pyridin-2-yl]disulfanyl]-4-methylpentanoic acid?
The IUPAC name of 4-[[1-(2,5-dioxopyrrolidin-1-yl)-5-nitro-2H-pyridin-2-yl]disulfanyl]-4-methylpentanoic acid (CID 87146001) is 4-[[1-(2,5-dioxopyrrolidin-1-yl)-5-nitro-2H-pyridin-2-yl]disulfanyl]-4-methylpentanoic acid.
What is the SMILES notation for 4-[[1-(2,5-dioxopyrrolidin-1-yl)-5-nitro-2H-pyridin-2-yl]disulfanyl]-4-methylpentanoic acid?
The canonical SMILES for 4-[[1-(2,5-dioxopyrrolidin-1-yl)-5-nitro-2H-pyridin-2-yl]disulfanyl]-4-methylpentanoic acid is CC(C)(CCC(=O)O)SSC1C=CC([N+](=O)[O-])=CN1N1C(=O)CCC1=O.
What is the InChIKey of 4-[[1-(2,5-dioxopyrrolidin-1-yl)-5-nitro-2H-pyridin-2-yl]disulfanyl]-4-methylpentanoic acid?
The InChIKey is OSKXOJDBDXGORR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O6S2/c1-15(2,8-7-14(21)22)26-25-13-6-3-10(18(23)24)9-16(13)17-11(19)4-5-12(17)20/h3,6,9,13H,4-5,7-8H2,1-2H3,(H,21,22).
What are the key properties of 4-[[1-(2,5-dioxopyrrolidin-1-yl)-5-nitro-2H-pyridin-2-yl]disulfanyl]-4-methylpentanoic acid?
4-[[1-(2,5-dioxopyrrolidin-1-yl)-5-nitro-2H-pyridin-2-yl]disulfanyl]-4-methylpentanoic acid has a molecular weight of 401.47 g/mol, XLogP of 2.39, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-(2,5-dioxopyrrolidin-1-yl)-5-nitro-2H-pyridin-2-yl]disulfanyl]-4-methylpentanoic acid is sourced from PubChem (CID 87146001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).