About iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydroiodide
iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydroiodide (PubChem CID 87146408) has the molecular formula C21H34BFeIN6
and a molecular weight of 564.11 g/mol. Its IUPAC name is iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydroiodide.
Molecular Properties
| Compound Name | iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydroiodide |
| PubChem CID | 87146408 |
| Molecular Formula | C21H34BFeIN6 |
| Molecular Weight | 564.11 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydroiodide |
| SMILES | CCc1n[nH]c(CC)c1B(c1c(CC)n[nH]c1CC)c1c(CC)n[nH]c1CC.I.[Fe] |
| InChI | InChI=1S/C21H33BN6.Fe.HI/c1-7-13-19(14(8-2)24-23-13)22(20-15(9-3)25-26-16(20)10-4)21-17(11-5)27-28-18(21)12-6;;/h7-12H2,1-6H3,(H,23,24)(H,25,26)(H,27,28);;1H |
| InChIKey | MOFVWHBAESUJNU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 564.11 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydroiodide?
The IUPAC name of iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydroiodide (CID 87146408) is iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydroiodide.
What is the SMILES notation for iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydroiodide?
The canonical SMILES for iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydroiodide is CCc1n[nH]c(CC)c1B(c1c(CC)n[nH]c1CC)c1c(CC)n[nH]c1CC.I.[Fe].
What is the InChIKey of iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydroiodide?
The InChIKey is MOFVWHBAESUJNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H33BN6.Fe.HI/c1-7-13-19(14(8-2)24-23-13)22(20-15(9-3)25-26-16(20)10-4)21-17(11-5)27-28-18(21)12-6;;/h7-12H2,1-6H3,(H,23,24)(H,25,26)(H,27,28);;1H.
What are the key properties of iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydroiodide?
iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydroiodide has a molecular weight of 564.11 g/mol, XLogP of 2.36, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydroiodide is sourced from PubChem (CID 87146408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).