C43H80Cl2N2O8 — CID 87147374
(Z)-18-[2-[[(2S)-2-amino-3-hydroxypropanoyl]-[2-[(Z)-octadec-9-enoyl]oxyethyl]amino]ethoxy]-18-oxooctadec-9-enoic acid;dihydrochloride (PubChem CID 87147374) has the molecular formula C43H80Cl2N2O8 and a molecular weight of 824.02 g/mol. Its IUPAC name is (Z)-18-[2-[[(2S)-2-amino-3-hydroxypropanoyl]-[2-[(Z)-octadec-9-enoyl]oxyethyl]amino]ethoxy]-18-oxooctadec-9-enoic acid;dihydrochloride.
| Compound Name | (Z)-18-[2-[[(2S)-2-amino-3-hydroxypropanoyl]-[2-[(Z)-octadec-9-enoyl]oxyethyl]amino]ethoxy]-18-oxooctadec-9-enoic acid;dihydrochloride |
|---|---|
| PubChem CID | 87147374 |
| Molecular Formula | C43H80Cl2N2O8 |
| Molecular Weight | 824.02 g/mol |
| Exact Mass | 822.53 |
| IUPAC Name | (Z)-18-[2-[[(2S)-2-amino-3-hydroxypropanoyl]-[2-[(Z)-octadec-9-enoyl]oxyethyl]amino]ethoxy]-18-oxooctadec-9-enoic acid;dihydrochloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCN(CCOC(=O)CCCCCCC/C=C\CCCCCCCC(=O)O)C(=O)[C@@H](N)CO.Cl.Cl |
| InChI | InChI=1S/C43H78N2O8.2ClH/c1-2-3-4-5-6-7-8-9-10-14-17-20-23-26-29-32-41(49)52-36-34-45(43(51)39(44)38-46)35-37-53-42(50)33-30-27-24-21-18-15-12-11-13-16-19-22-25-28-31-40(47)48;;/h9-12,39,46H,2-8,13-38,44H2,1H3,(H,47,48);2*1H/b10-9-,12-11-;;/t39-;;/m0../s1 |
| InChIKey | PCFBWJJEWMMGNY-LCKFPOOZSA-N |
| XLogP | 10.20 |
| TPSA | 156.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.02 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|