C32H40O7SSi — CID 87147547
[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6a-trimethyl-5,6-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl] 4-methylbenzenesulfonate (PubChem CID 87147547) has the molecular formula C32H40O7SSi and a molecular weight of 596.82 g/mol. Its IUPAC name is [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6a-trimethyl-5,6-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl] 4-methylbenzenesulfonate.
| Compound Name | [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6a-trimethyl-5,6-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87147547 |
| Molecular Formula | C32H40O7SSi |
| Molecular Weight | 596.82 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6a-trimethyl-5,6-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2C(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)OC3OC(C)(C)OC32C)cc1 |
| InChI | InChI=1S/C32H40O7SSi/c1-23-18-20-24(21-19-23)40(33,34)38-28-27(36-29-32(28,7)39-31(5,6)37-29)22-35-41(30(2,3)4,25-14-10-8-11-15-25)26-16-12-9-13-17-26/h8-21,27-29H,22H2,1-7H3 |
| InChIKey | WTWIMKTUODHSQN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.82 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|