About (2,4-difluorophenyl)methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate
(2,4-difluorophenyl)methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate (PubChem CID 87147738) has the molecular formula C20H17ClF2NO4P
and a molecular weight of 439.78 g/mol. Its IUPAC name is (2,4-difluorophenyl)methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate.
Molecular Properties
| Compound Name | (2,4-difluorophenyl)methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate |
| PubChem CID | 87147738 |
| Molecular Formula | C20H17ClF2NO4P |
| Molecular Weight | 439.78 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | (2,4-difluorophenyl)methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(Cl)Oc1cccc2ccccc12)C(=O)OCc1ccc(F)cc1F |
| InChI | InChI=1S/C20H17ClF2NO4P/c1-13(20(25)27-12-15-9-10-16(22)11-18(15)23)24-29(21,26)28-19-8-4-6-14-5-2-3-7-17(14)19/h2-11,13H,12H2,1H3,(H,24,26)/t13-,29?/m0/s1 |
| InChIKey | KXLXRNONNUVVNH-OOBPLEAZSA-N |
| XLogP | 5.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.78 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2,4-difluorophenyl)methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-difluorophenyl)methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate?
The IUPAC name of (2,4-difluorophenyl)methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate (CID 87147738) is (2,4-difluorophenyl)methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate.
What is the SMILES notation for (2,4-difluorophenyl)methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate?
The canonical SMILES for (2,4-difluorophenyl)methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate is C[C@H](NP(=O)(Cl)Oc1cccc2ccccc12)C(=O)OCc1ccc(F)cc1F.
What is the InChIKey of (2,4-difluorophenyl)methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate?
The InChIKey is KXLXRNONNUVVNH-OOBPLEAZSA-N. The full InChI is InChI=1S/C20H17ClF2NO4P/c1-13(20(25)27-12-15-9-10-16(22)11-18(15)23)24-29(21,26)28-19-8-4-6-14-5-2-3-7-17(14)19/h2-11,13H,12H2,1H3,(H,24,26)/t13-,29?/m0/s1.
What are the key properties of (2,4-difluorophenyl)methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate?
(2,4-difluorophenyl)methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate has a molecular weight of 439.78 g/mol, XLogP of 5.57, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-difluorophenyl)methyl (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]propanoate is sourced from PubChem (CID 87147738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).