C29H36O7SSi — CID 87147787
[(2S,3R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-4-methyloxolan-3-yl] 4-methylbenzenesulfonate (PubChem CID 87147787) has the molecular formula C29H36O7SSi and a molecular weight of 556.75 g/mol. Its IUPAC name is [(2S,3R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-4-methyloxolan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-4-methyloxolan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87147787 |
| Molecular Formula | C29H36O7SSi |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | [(2S,3R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-4-methyloxolan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)OC(O)[C@]2(C)O)cc1 |
| InChI | InChI=1S/C29H36O7SSi/c1-21-16-18-22(19-17-21)37(32,33)36-26-25(35-27(30)29(26,5)31)20-34-38(28(2,3)4,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-19,25-27,30-31H,20H2,1-5H3/t25-,26+,27?,29+/m0/s1 |
| InChIKey | HJPSNGKJLMKBMD-OGPMXUKJSA-N |
| XLogP | 3.11 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|