2-ethenylpenta-2,3-dienoic acid

C7H8O2 — CID 87148148

IUPAC2-ethenylpenta-2,3-dienoic acid
SMILESC=CC(=C=CC)C(=O)O
InChIInChI=1S/C7H8O2/c1-3-5-6(4-2)7(8)9/h3-4H,2H2,1H3,(H,8,9)
InChIKeyXVGCFRBEGMARAZ-UHFFFAOYSA-N
MW124.14 g/mol
LogP1.36
Rot. Bonds2

About 2-ethenylpenta-2,3-dienoic acid

2-ethenylpenta-2,3-dienoic acid (PubChem CID 87148148) has the molecular formula C7H8O2 and a molecular weight of 124.14 g/mol. Its IUPAC name is 2-ethenylpenta-2,3-dienoic acid.

Molecular Properties

Compound Name2-ethenylpenta-2,3-dienoic acid
PubChem CID87148148
Molecular FormulaC7H8O2
Molecular Weight124.14 g/mol
Exact Mass124.05
IUPAC Name2-ethenylpenta-2,3-dienoic acid
SMILESC=CC(=C=CC)C(=O)O
InChIInChI=1S/C7H8O2/c1-3-5-6(4-2)7(8)9/h3-4H,2H2,1H3,(H,8,9)
InChIKeyXVGCFRBEGMARAZ-UHFFFAOYSA-N
XLogP1.36
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500124.14
LogP ≤ 51.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 2-ethenylpenta-2,3-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethenylpenta-2,3-dienoic acid?
The IUPAC name of 2-ethenylpenta-2,3-dienoic acid (CID 87148148) is 2-ethenylpenta-2,3-dienoic acid.
What is the SMILES notation for 2-ethenylpenta-2,3-dienoic acid?
The canonical SMILES for 2-ethenylpenta-2,3-dienoic acid is C=CC(=C=CC)C(=O)O.
What is the InChIKey of 2-ethenylpenta-2,3-dienoic acid?
The InChIKey is XVGCFRBEGMARAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2/c1-3-5-6(4-2)7(8)9/h3-4H,2H2,1H3,(H,8,9).
What are the key properties of 2-ethenylpenta-2,3-dienoic acid?
2-ethenylpenta-2,3-dienoic acid has a molecular weight of 124.14 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylpenta-2,3-dienoic acid is sourced from PubChem (CID 87148148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).