About 5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine
5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine (PubChem CID 87148423) has the molecular formula C26H22N4O3S2
and a molecular weight of 502.62 g/mol. Its IUPAC name is 5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine.
Molecular Properties
| Compound Name | 5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine |
| PubChem CID | 87148423 |
| Molecular Formula | C26H22N4O3S2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine |
| SMILES | NCCNc1cccc2c(S(=O)(=O)O)cccc12.S=C=Nc1cccc2nc3ccccc3cc12 |
| InChI | InChI=1S/C14H8N2S.C12H14N2O3S/c17-9-15-13-6-3-7-14-11(13)8-10-4-1-2-5-12(10)16-14;13-7-8-14-11-5-1-4-10-9(11)3-2-6-12(10)18(15,16)17/h1-8H;1-6,14H,7-8,13H2,(H,15,16,17) |
| InChIKey | CISJCEGJLODEKU-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine?
The IUPAC name of 5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine (CID 87148423) is 5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine.
What is the SMILES notation for 5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine?
The canonical SMILES for 5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine is NCCNc1cccc2c(S(=O)(=O)O)cccc12.S=C=Nc1cccc2nc3ccccc3cc12.
What is the InChIKey of 5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine?
The InChIKey is CISJCEGJLODEKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2S.C12H14N2O3S/c17-9-15-13-6-3-7-14-11(13)8-10-4-1-2-5-12(10)16-14;13-7-8-14-11-5-1-4-10-9(11)3-2-6-12(10)18(15,16)17/h1-8H;1-6,14H,7-8,13H2,(H,15,16,17).
What are the key properties of 5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine?
5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine has a molecular weight of 502.62 g/mol, XLogP of 5.58, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine is sourced from PubChem (CID 87148423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).